CAS 1998655-38-1 is the registry number for Fmoc-L-Phe(4-iBu)-OH. Offered by: Iris Biotech. Available pack sizes: 50mg, 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(2-methylpropyl)phenyl]propanoic acid (CAS 1998655-38-1) is a chemical compound with the molecular formula C28H29NO4 and a molecular weight of 443.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(2-methylpropyl)phenyl]propanoic acid. InChIKey: YWOQIOLCLDLITA-SANMLTNESA-N.
| Molecular formula | C28H29NO4 |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(2-methylpropyl)phenyl]propanoic acid |
| InChIKey | YWOQIOLCLDLITA-SANMLTNESA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)