CAS 2104031-58-3 appears in our catalog under these names: Fmoc-Nva(5-(2,3-DiMethylphenyl)-OH 98%, Fmoc-(S)-2-amino-5-(3,5-dimethylphenyl)pentanoic acid, ≥95%, ≥95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-5-(3,5-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 2104031-58-3) is a chemical compound with the molecular formula C28H29NO4 and a molecular weight of 443.5 g/mol. IUPAC name: (2S)-5-(3,5-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: GIPDDLLVNQJIEO-SANMLTNESA-N.
| Molecular formula | C28H29NO4 |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | (2S)-5-(3,5-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | GIPDDLLVNQJIEO-SANMLTNESA-N |
| SMILES | CC1=CC(=CC(=C1)CCC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C |
Computed by PubChem (NCBI)