CAS 213383-02-9 appears in our catalog under these names: Fmoc-L-4-tert-butyl-Phe, 97%, Fmoc–p–tBu–Phe–OH, Fmoc-Phe(4-tBu)-OH 98%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-(tert-butyl)phenyl)propanoic acid, 95%, 95%, Fmoc-Phe(4-tBu)-OH, 99.94%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100mg, 1 g, 250 mg.
(2S)-3-(4-tert-butylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 213383-02-9) is a chemical compound with the molecular formula C28H29NO4 and a molecular weight of 443.5 g/mol. IUPAC name: (2S)-3-(4-tert-butylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: OKEORFXNCSRZFL-VWLOTQADSA-N.
| Molecular formula | C28H29NO4 |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | (2S)-3-(4-tert-butylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | OKEORFXNCSRZFL-VWLOTQADSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)