Products 199926-19-7
CAS 199926-19-7 is the registry number for 4-Amino-l-phenylalanine xhydrate, 98+%. Offered by: AmBeed. Available pack sizes: 5g, 250mg, 1g.
(2S)-2-amino-3-(4-aminophenyl)propanoic acid;hydrate (CAS 199926-19-7) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: (2S)-2-amino-3-(4-aminophenyl)propanoic acid;hydrate. InChIKey: LPKPWQCBWORKIP-QRPNPIFTSA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-aminophenyl)propanoic acid;hydrate |
| InChIKey | LPKPWQCBWORKIP-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)N)N.O |
Computed by PubChem (NCBI)
Synonyms:
4-Amino-L-phenylalanine hydrate, 4-Amino-L-phenylalanine monohydrate, (S)-2-Amino-3-(4-aminophenyl)propanoic acid hydrate, (2S)-2-amino-3-(4-aminophenyl)propanoic acid;hydrate, 4-Amino-l-phenylalanine xhydrate, (2S)-2-amino-3-(4-aminophenyl)propanoic acid hydrate, 4-Amino-l-phenylalaninexhydrate, L-Phenylalanine, 4-amino-, hydrate (9CI)