Products 199996-77-5
CAS 199996-77-5 is the registry number for Vavain. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-7-methoxychromen-4-one (CAS 199996-77-5) is a chemical compound with the molecular formula C18H16O7 and a molecular weight of 344.3 g/mol. IUPAC name: 5-hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-7-methoxychromen-4-one. InChIKey: KIIFCUFZMOWDHR-UHFFFAOYSA-N.
| Molecular formula | C18H16O7 |
|---|---|
| Molecular weight | 344.3 g/mol |
| IUPAC name | 5-hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-7-methoxychromen-4-one |
| InChIKey | KIIFCUFZMOWDHR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)OC=C(C2=O)C3=CC(=C(C(=C3)OC)OC)O)O |
Computed by PubChem (NCBI)