CAS 214360-46-0 appears in our catalog under these names: 3-Cyanophenylboronic acid pinacol ester, 3–Cyanophenylboronic acid pinacol ester, 3-Cyanobenzeneboronic acid pinacol ester, 97% , 3-Cyanophenylboronic acid pinacol ester, 97%, 3-CYANOPHENYLBORONIC ACID PINACOL ESTER,. Offered by: Chemat Brand, GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: on request, 25g, 1g, 5g, 10g, 100g, 500g.
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 214360-46-0) is a chemical compound with the molecular formula C13H16BNO2 and a molecular weight of 229.08 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: FIGQEPXOSAFKTA-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO2 |
|---|---|
| Molecular weight | 229.08 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | FIGQEPXOSAFKTA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C#N |
Computed by PubChem (NCBI)