CAS 200192-48-9 appears in our catalog under these names: Boc-d-asn(xan)-oh, 98%, Boc–D–Asn(Xan)–OH, Boc-D-Asn(Xan)-OH, Boc-D-Asn(Xan)-OH, ≥98%, ≥98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat. Available pack sizes: 25g, 5g, 1g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(9H-xanthen-9-ylamino)butanoic acid (CAS 200192-48-9) is a chemical compound with the molecular formula C22H24N2O6 and a molecular weight of 412.4 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(9H-xanthen-9-ylamino)butanoic acid. InChIKey: YMGDQLXBNMRJMR-OAHLLOKOSA-N.
| Molecular formula | C22H24N2O6 |
|---|---|
| Molecular weight | 412.4 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(9H-xanthen-9-ylamino)butanoic acid |
| InChIKey | YMGDQLXBNMRJMR-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)NC1C2=CC=CC=C2OC3=CC=CC=C13)C(=O)O |
Computed by PubChem (NCBI)