CAS 293761-41-8 is the registry number for 4,4'-((3,3'-Dimethyl-[1,1'-biphenyl]-4,4'-diyl)bis(azanediyl))bis(4-oxobutanoic acid), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-[4-(3-carboxypropanoylamino)-3-methylphenyl]-2-methylanilino]-4-oxobutanoic acid (CAS 293761-41-8) is a chemical compound with the molecular formula C22H24N2O6 and a molecular weight of 412.4 g/mol. IUPAC name: 4-[4-[4-(3-carboxypropanoylamino)-3-methylphenyl]-2-methylanilino]-4-oxobutanoic acid. InChIKey: FMLIJUCXKOYSFK-UHFFFAOYSA-N.
| Molecular formula | C22H24N2O6 |
|---|---|
| Molecular weight | 412.4 g/mol |
| IUPAC name | 4-[4-[4-(3-carboxypropanoylamino)-3-methylphenyl]-2-methylanilino]-4-oxobutanoic acid |
| InChIKey | FMLIJUCXKOYSFK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)NC(=O)CCC(=O)O)C)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)