Products 7177-93-7

CAS 7177-93-7 is the registry number for 2,2'-((Hexane-1,6-diylbis(azanediyl))bis(carbonyl))dibenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[6-[(2-carboxybenzoyl)amino]hexylcarbamoyl]benzoic acid (CAS 7177-93-7) is a chemical compound with the molecular formula C22H24N2O6 and a molecular weight of 412.4 g/mol. IUPAC name: 2-[6-[(2-carboxybenzoyl)amino]hexylcarbamoyl]benzoic acid. InChIKey: YZHDSARBKQQNHN-UHFFFAOYSA-N.

Identity
Molecular formulaC22H24N2O6
Molecular weight412.4 g/mol
IUPAC name2-[6-[(2-carboxybenzoyl)amino]hexylcarbamoyl]benzoic acid
InChIKeyYZHDSARBKQQNHN-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NCCCCCCNC(=O)C2=CC=CC=C2C(=O)O)C(=O)O

Computed by PubChem (NCBI)