Products 2003213-07-6
CAS 2003213-07-6 is the registry number for BuChE-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[[1-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]triazol-4-yl]methyl]indole-2,3-dione (CAS 2003213-07-6) is a chemical compound with the molecular formula C21H26N4O2 and a molecular weight of 366.5 g/mol. IUPAC name: 1-[[1-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]triazol-4-yl]methyl]indole-2,3-dione. InChIKey: KESHTJCSTIPJBH-ALKREAHSSA-N.
| Molecular formula | C21H26N4O2 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | 1-[[1-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]triazol-4-yl]methyl]indole-2,3-dione |
| InChIKey | KESHTJCSTIPJBH-ALKREAHSSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@H](C1)N2C=C(N=N2)CN3C4=CC=CC=C4C(=O)C3=O)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
BuChE-IN-6, orb1688618