CAS 20050-17-3 appears in our catalog under these names: (S)–1–Mesitylethanamine, (S)-1-Mesitylethanamine, 95%, 95%, (S)-1-Mesitylethanamine, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(1S)-1-(2,4,6-trimethylphenyl)ethanamine (CAS 20050-17-3) is a chemical compound with the molecular formula C11H17N and a molecular weight of 163.26 g/mol. IUPAC name: (1S)-1-(2,4,6-trimethylphenyl)ethanamine. InChIKey: LVIICDKJNNIEQG-JTQLQIEISA-N.
| Molecular formula | C11H17N |
|---|---|
| Molecular weight | 163.26 g/mol |
| IUPAC name | (1S)-1-(2,4,6-trimethylphenyl)ethanamine |
| InChIKey | LVIICDKJNNIEQG-JTQLQIEISA-N |
| SMILES | CC1=CC(=C(C(=C1)C)[C@H](C)N)C |
Computed by PubChem (NCBI)