CAS 2006276-90-8 appears in our catalog under these names: 7-(Aminomethyl)benzoxazole hydrochloride, 95%, 7-(Aminomethyl)benzoxazole Hydrochloride, >95%, >95%, 7-(AMINOMETHYL)BENZOXAZOLE HCL, >95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
1,3-benzoxazol-7-ylmethanamine;hydrochloride (CAS 2006276-90-8) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 1,3-benzoxazol-7-ylmethanamine;hydrochloride. InChIKey: KMLREPALNRLYAT-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 1,3-benzoxazol-7-ylmethanamine;hydrochloride |
| InChIKey | KMLREPALNRLYAT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)N=CO2)CN.Cl |
Computed by PubChem (NCBI)