Products 2007909-38-6

CAS 2007909-38-6 is the registry number for azetidine-2-carbonitrile hemi(oxalic acid), 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Bis(azetidine-2-carbonitrile);oxalic acid (CAS 2007909-38-6) is a chemical compound with the molecular formula C10H14N4O4 and a molecular weight of 254.24 g/mol. IUPAC name: bis(azetidine-2-carbonitrile);oxalic acid. InChIKey: OODAFZBGMZZKNL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14N4O4
Molecular weight254.24 g/mol
IUPAC namebis(azetidine-2-carbonitrile);oxalic acid
InChIKeyOODAFZBGMZZKNL-UHFFFAOYSA-N
SMILESC1CNC1C#N.C1CNC1C#N.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)