CAS 2068137-88-0 is the registry number for Bis((2s)-azetidine-2-carbonitrile), oxalic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Bis((2S)-azetidine-2-carbonitrile);oxalic acid (CAS 2068137-88-0) is a chemical compound with the molecular formula C10H14N4O4 and a molecular weight of 254.24 g/mol. IUPAC name: bis((2S)-azetidine-2-carbonitrile);oxalic acid. InChIKey: OODAFZBGMZZKNL-SCGRZTRASA-N.
| Molecular formula | C10H14N4O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | bis((2S)-azetidine-2-carbonitrile);oxalic acid |
| InChIKey | OODAFZBGMZZKNL-SCGRZTRASA-N |
| SMILES | C1CN[C@@H]1C#N.C1CN[C@@H]1C#N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)