CAS 866363-70-4 appears in our catalog under these names: N3-C5-NHS ester/ 99.76% (existing batch purity), N3–C5–NHS ester, N3-Aca-OSu, 6-Azidocaproic acid N-hydroxysuccinimidyl ester, 2,5-Dioxopyrrolidin-1-yl 6-Azidohexanoate, >95.0%(qNMR). Offered by: TargetMol, GLPBio, Iris Biotech, Biosynth, TCI. Available pack sizes: 50mg, 100mg, 500mg, 1g, 5g, 250mg, 100 mg, 1 g.
(2,5-dioxopyrrolidin-1-yl) 6-azidohexanoate (CAS 866363-70-4) is a chemical compound with the molecular formula C10H14N4O4 and a molecular weight of 254.24 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 6-azidohexanoate. InChIKey: FVWGCTQOFSJEDB-UHFFFAOYSA-N.
| Molecular formula | C10H14N4O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 6-azidohexanoate |
| InChIKey | FVWGCTQOFSJEDB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)