CAS 2007909-88-6 is the registry number for Ethyl 3-((3,4-dichlorophenyl)(ethyl)amino)-3-oxopropanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Ethyl 3-(3,4-dichloro-N-ethylanilino)-3-oxopropanoate (CAS 2007909-88-6) is a chemical compound with the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. IUPAC name: ethyl 3-(3,4-dichloro-N-ethylanilino)-3-oxopropanoate. InChIKey: FKPMKSLYNDNYII-UHFFFAOYSA-N.
| Molecular formula | C13H15Cl2NO3 |
|---|---|
| Molecular weight | 304.17 g/mol |
| IUPAC name | ethyl 3-(3,4-dichloro-N-ethylanilino)-3-oxopropanoate |
| InChIKey | FKPMKSLYNDNYII-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC(=C(C=C1)Cl)Cl)C(=O)CC(=O)OCC |
Computed by PubChem (NCBI)