Products 496019-58-0
CAS 496019-58-0 is the registry number for (2S)-2-((2,4-Dichlorophenyl)formamido)-4-methylpentanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S)-2-[(2,4-dichlorobenzoyl)amino]-4-methylpentanoic acid (CAS 496019-58-0) is a chemical compound with the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. IUPAC name: (2S)-2-[(2,4-dichlorobenzoyl)amino]-4-methylpentanoic acid. InChIKey: RKLNYXBGSUTCSH-NSHDSACASA-N.
| Molecular formula | C13H15Cl2NO3 |
|---|---|
| Molecular weight | 304.17 g/mol |
| IUPAC name | (2S)-2-[(2,4-dichlorobenzoyl)amino]-4-methylpentanoic acid |
| InChIKey | RKLNYXBGSUTCSH-NSHDSACASA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)