CAS 2168560-14-1 is the registry number for 1-(2,6-Dichloro-3,5-dimethoxyphenyl)piperidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,6-dichloro-3,5-dimethoxyphenyl)piperidin-4-one (CAS 2168560-14-1) is a chemical compound with the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. IUPAC name: 1-(2,6-dichloro-3,5-dimethoxyphenyl)piperidin-4-one. InChIKey: OGJDELWGCUSHHP-UHFFFAOYSA-N.
| Molecular formula | C13H15Cl2NO3 |
|---|---|
| Molecular weight | 304.17 g/mol |
| IUPAC name | 1-(2,6-dichloro-3,5-dimethoxyphenyl)piperidin-4-one |
| InChIKey | OGJDELWGCUSHHP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1Cl)N2CCC(=O)CC2)Cl)OC |
Computed by PubChem (NCBI)