CAS 2007916-85-8 is the registry number for 2-((tert-Butoxycarbonyl)(carboxymethyl)amino)thiazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[carboxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-4-carboxylic acid (CAS 2007916-85-8) is a chemical compound with the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. IUPAC name: 2-[carboxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-4-carboxylic acid. InChIKey: AMVAMBCRXIPLEK-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O6S |
|---|---|
| Molecular weight | 302.31 g/mol |
| IUPAC name | 2-[carboxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-4-carboxylic acid |
| InChIKey | AMVAMBCRXIPLEK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CC(=O)O)C1=NC(=CS1)C(=O)O |
Computed by PubChem (NCBI)