CAS 33662-45-2 is the registry number for (R)-2-(((Benzyloxy)carbonyl)amino)-3-sulfamoylpropanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(phenylmethoxycarbonylamino)-3-sulfamoylpropanoic acid (CAS 33662-45-2) is a chemical compound with the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. IUPAC name: (2R)-2-(phenylmethoxycarbonylamino)-3-sulfamoylpropanoic acid. InChIKey: BNTMRJDHXDDTKO-VIFPVBQESA-N.
| Molecular formula | C11H14N2O6S |
|---|---|
| Molecular weight | 302.31 g/mol |
| IUPAC name | (2R)-2-(phenylmethoxycarbonylamino)-3-sulfamoylpropanoic acid |
| InChIKey | BNTMRJDHXDDTKO-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CS(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)