CAS 895153-23-8 appears in our catalog under these names: N-Boc-4-nitrobenzenesulfonamide, 90%, tert–Butyl (4–nitrophenyl)sulfonylcarbamate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl N-(4-nitrophenyl)sulfonylcarbamate (CAS 895153-23-8) is a chemical compound with the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. IUPAC name: tert-butyl N-(4-nitrophenyl)sulfonylcarbamate. InChIKey: KURDKBAAQRGXSB-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O6S |
|---|---|
| Molecular weight | 302.31 g/mol |
| IUPAC name | tert-butyl N-(4-nitrophenyl)sulfonylcarbamate |
| InChIKey | KURDKBAAQRGXSB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)