CAS 2008-71-1 is the registry number for 1-(3-Chlorophenyl)-3-phenylurea. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 1000mg.
1-(3-chlorophenyl)-3-phenylurea (CAS 2008-71-1) is a chemical compound with the molecular formula C13H11ClN2O and a molecular weight of 246.69 g/mol. IUPAC name: 1-(3-chlorophenyl)-3-phenylurea. InChIKey: BQVXYHYXISZSEZ-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-3-phenylurea |
| InChIKey | BQVXYHYXISZSEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)NC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)