Products 200813-31-6
CAS 200813-31-6 is the registry number for 16-Nor-15-oxodehydroabietic acid. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
7-acetyl-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (CAS 200813-31-6) is a chemical compound with the molecular formula C19H24O3 and a molecular weight of 300.4 g/mol. IUPAC name: 7-acetyl-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid. InChIKey: VUSNLFYUMKLEAV-UHFFFAOYSA-N.
| Molecular formula | C19H24O3 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | 7-acetyl-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| InChIKey | VUSNLFYUMKLEAV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C3(CCCC(C3CC2)(C)C(=O)O)C |
Computed by PubChem (NCBI)