Products 211814-30-1
CAS 211814-30-1 appears in our catalog under these names: Angustanoic acid G, Angustanoic acid G, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 5mg.
(1S,4aS,10aR)-7-acetyl-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (CAS 211814-30-1) is a chemical compound with the molecular formula C19H24O3 and a molecular weight of 300.4 g/mol. IUPAC name: (1S,4aS,10aR)-7-acetyl-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid. InChIKey: VUSNLFYUMKLEAV-QRQLOZEOSA-N.
| Molecular formula | C19H24O3 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | (1S,4aS,10aR)-7-acetyl-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| InChIKey | VUSNLFYUMKLEAV-QRQLOZEOSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)[C@]3(CCC[C@]([C@@H]3CC2)(C)C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
Angustanoic acid G, orb1941661