CAS 2010-63-1 is the registry number for 4-Chloro-(2-hydroxyhexafluoroisopropyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(4-chlorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (CAS 2010-63-1) is a chemical compound with the molecular formula C9H5ClF6O and a molecular weight of 278.58 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol. InChIKey: BDVVJTPJVCAQGG-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF6O |
|---|---|
| Molecular weight | 278.58 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChIKey | BDVVJTPJVCAQGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)(C(F)(F)F)O)Cl |
Computed by PubChem (NCBI)