CAS 2229269-48-9 is the registry number for 1-(4-Chloro-2-(trifluoromethyl)phenyl)-2,2,2-trifluoroethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[4-chloro-2-(trifluoromethyl)phenyl]-2,2,2-trifluoroethanol (CAS 2229269-48-9) is a chemical compound with the molecular formula C9H5ClF6O and a molecular weight of 278.58 g/mol. IUPAC name: 1-[4-chloro-2-(trifluoromethyl)phenyl]-2,2,2-trifluoroethanol. InChIKey: JQHQCMZQOOUQHH-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF6O |
|---|---|
| Molecular weight | 278.58 g/mol |
| IUPAC name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-2,2,2-trifluoroethanol |
| InChIKey | JQHQCMZQOOUQHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)C(C(F)(F)F)O |
Computed by PubChem (NCBI)