CAS 2733398-76-8 is the registry number for 2-(3-Chlorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chlorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (CAS 2733398-76-8) is a chemical compound with the molecular formula C9H5ClF6O and a molecular weight of 278.58 g/mol. IUPAC name: 2-(3-chlorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol. InChIKey: MHONHFLVBMRYSP-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF6O |
|---|---|
| Molecular weight | 278.58 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChIKey | MHONHFLVBMRYSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)