CAS 2011-66-7 appears in our catalog under these names: Clonazepam Impurity B(USP), Clonazepam Impurity 2, 2-Amino-5-nitro-2'-chlorobenzophenone, >95% (HPLC), (2-Amino-5-nitrophenyl)(2-chlorophenyl)methanone, 2–Amino–2'–chloro–5–nitrobenzophenone. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 100mg, 25mg, 1mg, 5mg, 25g, 100g, 10g.
(2-amino-5-nitrophenyl)-(2-chlorophenyl)methanone (CAS 2011-66-7) is a chemical compound with the molecular formula C13H9ClN2O3 and a molecular weight of 276.67 g/mol. IUPAC name: (2-amino-5-nitrophenyl)-(2-chlorophenyl)methanone. InChIKey: GRDGBWVSVMLKBV-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O3 |
|---|---|
| Molecular weight | 276.67 g/mol |
| IUPAC name | (2-amino-5-nitrophenyl)-(2-chlorophenyl)methanone |
| InChIKey | GRDGBWVSVMLKBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)[N+](=O)[O-])N)Cl |
Computed by PubChem (NCBI)