CAS 41562-57-6 appears in our catalog under these names: N-(4-Chlorophenyl)-2-nitrobenzamide, 95%, N-(4-Chlorophenyl)-2-nitrobenzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10000mg.
N-(4-chlorophenyl)-2-nitrobenzamide (CAS 41562-57-6) is a chemical compound with the molecular formula C13H9ClN2O3 and a molecular weight of 276.67 g/mol. IUPAC name: N-(4-chlorophenyl)-2-nitrobenzamide. InChIKey: XCENMAGLUPDPPI-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O3 |
|---|---|
| Molecular weight | 276.67 g/mol |
| IUPAC name | N-(4-chlorophenyl)-2-nitrobenzamide |
| InChIKey | XCENMAGLUPDPPI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)