Products 55501-45-6
CAS 55501-45-6 appears in our catalog under these names: 2-Chloro-N-(4-nitrophenyl)benzamide, 95+%, 2-Chloro-4'-nitrobenzanilide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g, 250mg, 500mg.
2-chloro-N-(4-nitrophenyl)benzamide (CAS 55501-45-6) is a chemical compound with the molecular formula C13H9ClN2O3 and a molecular weight of 276.67 g/mol. IUPAC name: 2-chloro-N-(4-nitrophenyl)benzamide. InChIKey: JKUFTSLAJUZNNM-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O3 |
|---|---|
| Molecular weight | 276.67 g/mol |
| IUPAC name | 2-chloro-N-(4-nitrophenyl)benzamide |
| InChIKey | JKUFTSLAJUZNNM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)