Products 201166-22-5
CAS 201166-22-5 appears in our catalog under these names: 4-Isopropyl-2,2-dimethylbenzo[d][1,3]dioxole, 95%, Propofol EP Impurity L, 2,2-Dimethyl-4-isopropyl-1,3-benzodioxole, >95% (HPLC), 2,2-Dimethyl-4-(1-methylethyl)-1,3-benzodioxole, 2,2–Dimethyl–4–(1–methylethyl)–1,3–benzodioxole. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg, on request, 2,5mg, 25mg.
2,2-dimethyl-4-propan-2-yl-1,3-benzodioxole (CAS 201166-22-5) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 2,2-dimethyl-4-propan-2-yl-1,3-benzodioxole. InChIKey: DHDJXCHGRUOYCV-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 2,2-dimethyl-4-propan-2-yl-1,3-benzodioxole |
| InChIKey | DHDJXCHGRUOYCV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C2C(=CC=C1)OC(O2)(C)C |
Computed by PubChem (NCBI)
Synonyms:
1,3-Benzodioxole, 2,2-dimethyl-4-(1-methylethyl)-, 2,2-Dimethyl-4-(1-methylethyl)-1,3-benzodioxole, Propofol specified impurity L [EP], PROPOFOL IMPURITY L [EP IMPURITY], PROPOFOL IMPURITY L (EP IMPURITY), Propofol specified impurity L, 4-Isopropyl-2,2-dimethylbenzo[d][1,3]dioxole, Propofol EP Impurity L, 2,2-dimethyl-4-propan-2-yl-1,3-benzodioxole, 2,2-dimethyl-4-(propan-2-yl)-2H-1,3-benzodioxole