Products 2012839-67-5
CAS 2012839-67-5 is the registry number for 3-(3-bromophenyl)-2,4-dimethylpentan-3-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(3-bromophenyl)-2,4-dimethylpentan-3-ol (CAS 2012839-67-5) is a chemical compound with the molecular formula C13H19BrO and a molecular weight of 271.19 g/mol. IUPAC name: 3-(3-bromophenyl)-2,4-dimethylpentan-3-ol. InChIKey: CCYKCFBMRRXWDY-UHFFFAOYSA-N.
| Molecular formula | C13H19BrO |
|---|---|
| Molecular weight | 271.19 g/mol |
| IUPAC name | 3-(3-bromophenyl)-2,4-dimethylpentan-3-ol |
| InChIKey | CCYKCFBMRRXWDY-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC(=CC=C1)Br)(C(C)C)O |
Computed by PubChem (NCBI)