CAS 201404-86-6 is the registry number for tert-Butyl (4R)-4-(2-hydroxyethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Tert-butyl (4R)-4-(2-hydroxyethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (CAS 201404-86-6) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: tert-butyl (4R)-4-(2-hydroxyethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate. InChIKey: ZJICPKTZDLBRQH-SECBINFHSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | tert-butyl (4R)-4-(2-hydroxyethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| InChIKey | ZJICPKTZDLBRQH-SECBINFHSA-N |
| SMILES | CC1(N([C@@H](CO1)CCO)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)