CAS 53462-50-3 appears in our catalog under these names: Boc-n-me-d-allo-ile-oh, 95%, Boc-n-me-d-allo-ile-oh, >95%, >95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
(2R,3S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid (CAS 53462-50-3) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (2R,3S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid. InChIKey: HTBIAUMDQYXOFG-DTWKUNHWSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (2R,3S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid |
| InChIKey | HTBIAUMDQYXOFG-DTWKUNHWSA-N |
| SMILES | CC[C@H](C)[C@H](C(=O)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)