CAS 1268729-59-4 appears in our catalog under these names: methyl (2R)-2-{[(tert-butoxy)carbonyl](methyl)amino}-3-methylbutanoate, 95%, N-Boc-MeVal, 96.37%. Offered by: Combi-blocks, MedChemExpress. Available pack sizes: 5g, 1g, 1 g, 100 mg.
Methyl (2R)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoate (CAS 1268729-59-4) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: methyl (2R)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoate. InChIKey: JHELVJNRWQYMIA-SECBINFHSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | methyl (2R)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoate |
| InChIKey | JHELVJNRWQYMIA-SECBINFHSA-N |
| SMILES | CC(C)[C@H](C(=O)OC)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)