CAS 201417-01-8 appears in our catalog under these names: D-Glucose-13C6,d7, >95% (HPLC), D–Glucose–13C6,d7, D-Glucose-13C6,d7, D-GLUCOSE-13C6-1,2,3,4,5,6,6-D7, 99 ATO&, D-Glucose-¹³C₆,1,2,3,4,5,6,6-d₇, 99+ atom% 13C,97+ atom% D,98%+,RG, 99+ atom% 13C,97+ atom% D,98%+,RG. Offered by: TRC, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 1g, 10mg, 25mg, 5mg, 50mg, 0,1g, 0,25g.
(2R,3S,4R,5R)-1,2,3,4,5,6,6-heptadeuterio-2,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexan-1-one (CAS 201417-01-8) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 193.16 g/mol. IUPAC name: (2R,3S,4R,5R)-1,2,3,4,5,6,6-heptadeuterio-2,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexan-1-one. InChIKey: GZCGUPFRVQAUEE-VVZLUFAVSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | (2R,3S,4R,5R)-1,2,3,4,5,6,6-heptadeuterio-2,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexan-1-one |
| InChIKey | GZCGUPFRVQAUEE-VVZLUFAVSA-N |
| SMILES | [2H][13C](=O)[13C@@]([2H])([13C@]([2H])([13C@@]([2H])([13C@@]([2H])([13C]([2H])([2H])O)O)O)O)O |
Computed by PubChem (NCBI)