Products 201417-12-1
CAS 201417-12-1 is the registry number for L-DOPA-13C6, 99.11%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
(2S)-2-amino-3-(3,4-dihydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)propanoic acid (CAS 201417-12-1) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 203.14 g/mol. IUPAC name: (2S)-2-amino-3-(3,4-dihydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)propanoic acid. InChIKey: WTDRDQBEARUVNC-XXRLIUPJSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | (2S)-2-amino-3-(3,4-dihydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)propanoic acid |
| InChIKey | WTDRDQBEARUVNC-XXRLIUPJSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13C]([13CH]=[13C]1C[C@@H](C(=O)O)N)O)O |
Computed by PubChem (NCBI)