Products 713140-70-6
CAS 713140-70-6 is the registry number for SD-1077. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-amino-2,3,3-trideuterio-3-(3,4-dihydroxyphenyl)propanoic acid (CAS 713140-70-6) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 200.21 g/mol. IUPAC name: (2S)-2-amino-2,3,3-trideuterio-3-(3,4-dihydroxyphenyl)propanoic acid. InChIKey: WTDRDQBEARUVNC-QZRTVAIESA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | (2S)-2-amino-2,3,3-trideuterio-3-(3,4-dihydroxyphenyl)propanoic acid |
| InChIKey | WTDRDQBEARUVNC-QZRTVAIESA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])C1=CC(=C(C=C1)O)O)N |
Computed by PubChem (NCBI)