Products 713140-75-1
CAS 713140-75-1 appears in our catalog under these names: L–DOPA–d6, L-Dopa-2,5,6,alpha,beta,beta-d6, 99 atom % D, min 98% Chemical Purity, L-DOPA-d6, 99.50%. Offered by: GLPBio, CDN, MedChemExpress. Available pack sizes: 1mg, 0,01g, 0,005g, 1 mg.
(2S)-2-amino-2,3,3-trideuterio-3-(2,3,6-trideuterio-4,5-dihydroxyphenyl)propanoic acid (CAS 713140-75-1) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 203.22 g/mol. IUPAC name: (2S)-2-amino-2,3,3-trideuterio-3-(2,3,6-trideuterio-4,5-dihydroxyphenyl)propanoic acid. InChIKey: WTDRDQBEARUVNC-ZAZUUIAJSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 203.22 g/mol |
| IUPAC name | (2S)-2-amino-2,3,3-trideuterio-3-(2,3,6-trideuterio-4,5-dihydroxyphenyl)propanoic acid |
| InChIKey | WTDRDQBEARUVNC-ZAZUUIAJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[C@@]([2H])(C(=O)O)N)[2H])O)O)[2H] |
Computed by PubChem (NCBI)