CAS 20150-84-9 appears in our catalog under these names: 6-Methylquinolin-2-amine, 95+%, 6–Methylquinolin–2–amine, 6-Methylquinolin-2-amine, 95%, 95%, 6-METHYLQUINOLIN-2-AMINE, 95%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 1g, 250mg.
6-methylquinolin-2-amine (CAS 20150-84-9) is a chemical compound with the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. IUPAC name: 6-methylquinolin-2-amine. InChIKey: RQQLHRZJJNJFJR-UHFFFAOYSA-N.
| Molecular formula | C10H10N2 |
|---|---|
| Molecular weight | 158.20 g/mol |
| IUPAC name | 6-methylquinolin-2-amine |
| InChIKey | RQQLHRZJJNJFJR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C=C2)N |
Computed by PubChem (NCBI)