CAS 20151-45-5 is the registry number for 8-methylquinolin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
8-methylquinolin-2-amine (CAS 20151-45-5) is a chemical compound with the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. IUPAC name: 8-methylquinolin-2-amine. InChIKey: FQSZUOSKHMTGMC-UHFFFAOYSA-N.
| Molecular formula | C10H10N2 |
|---|---|
| Molecular weight | 158.20 g/mol |
| IUPAC name | 8-methylquinolin-2-amine |
| InChIKey | FQSZUOSKHMTGMC-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C=CC(=N2)N |
Computed by PubChem (NCBI)