Products 2015396-14-0
CAS 2015396-14-0 is the registry number for (2S)-Fmoc-3-(5-methylthien-2-yl)alanine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-methylthiophen-2-yl)propanoic acid (CAS 2015396-14-0) is a chemical compound with the molecular formula C23H21NO4S and a molecular weight of 407.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-methylthiophen-2-yl)propanoic acid. InChIKey: FQJDVTIAKRHYJJ-NRFANRHFSA-N.
| Molecular formula | C23H21NO4S |
|---|---|
| Molecular weight | 407.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-methylthiophen-2-yl)propanoic acid |
| InChIKey | FQJDVTIAKRHYJJ-NRFANRHFSA-N |
| SMILES | CC1=CC=C(S1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
Synonyms:
(2S)-Fmoc-3-(5-methylthien-2-yl)alanine