CAS 269726-90-1 appears in our catalog under these names: Fmoc-(r)-3-amino-4-(2-thienyl)-butyric acid, 95%, Fmoc–(2–thienyl)–D–beta–homoalanine, Fmoc-(R)-3-Amino-4-(2-thienyl)-butyric acid, 98%, 98%, Fmoc-(R)-3-Amino-4-(2-thienyl)-butyric acid, 97%, Fmoc-(R)-3-Amino-4-(2-thienyl)-butyricacid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-thiophen-2-ylbutanoic acid (CAS 269726-90-1) is a chemical compound with the molecular formula C23H21NO4S and a molecular weight of 407.5 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-thiophen-2-ylbutanoic acid. InChIKey: BESSJJJDKGERSD-HNNXBMFYSA-N.
| Molecular formula | C23H21NO4S |
|---|---|
| Molecular weight | 407.5 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-thiophen-2-ylbutanoic acid |
| InChIKey | BESSJJJDKGERSD-HNNXBMFYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=CS4)CC(=O)O |
Computed by PubChem (NCBI)