CAS 270263-01-9 appears in our catalog under these names: Fmoc-(s)-3-amino-4-(3-thienyl)-butyric acid, 95%, (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(thiophen-3-yl)butanoic acid, ≥95%, ≥95%, Fmoc-(S)-3-Amino-4-(3-thienyl)-butyric acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-thiophen-3-ylbutanoic acid (CAS 270263-01-9) is a chemical compound with the molecular formula C23H21NO4S and a molecular weight of 407.5 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-thiophen-3-ylbutanoic acid. InChIKey: LLLVDBJEAPYRRR-INIZCTEOSA-N.
| Molecular formula | C23H21NO4S |
|---|---|
| Molecular weight | 407.5 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-thiophen-3-ylbutanoic acid |
| InChIKey | LLLVDBJEAPYRRR-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CSC=C4)CC(=O)O |
Computed by PubChem (NCBI)