CAS 374089-83-5 appears in our catalog under these names: D–Fructose–d, D-Fructose-d, 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 50 mg, 5 mg, 10 mg, 100 mg, 25 mg.
(1R,3S,4R,5R)-1-deuterio-1,3,4,5,6-pentahydroxyhexan-2-one (CAS 374089-83-5) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.16 g/mol. IUPAC name: (1R,3S,4R,5R)-1-deuterio-1,3,4,5,6-pentahydroxyhexan-2-one. InChIKey: BJHIKXHVCXFQLS-KWZZJJANSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | (1R,3S,4R,5R)-1-deuterio-1,3,4,5,6-pentahydroxyhexan-2-one |
| InChIKey | BJHIKXHVCXFQLS-KWZZJJANSA-N |
| SMILES | [H][C@@]([2H])(C(=O)[C@H]([C@@H]([C@@H](CO)O)O)O)O |
Computed by PubChem (NCBI)