Products 201595-67-7
CAS 201595-67-7 appears in our catalog under these names: Succinic Acid-13C4, Succinic Acid-13C4, >95% (HPLC), Succinic acid–13C4, SUCCINIC-13C4 ACID, 99 ATOM % 13C, Succinic acid-13C4, 99.70%. Offered by: Chemat Brand, TRC, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 1mg, 5mg, 100MG, 250MG, 5 mg.
(1,2,3,4-13C4)butanedioic acid (CAS 201595-67-7) is a chemical compound with the molecular formula C4H6O4 and a molecular weight of 122.059 g/mol. IUPAC name: (1,2,3,4-13C4)butanedioic acid. InChIKey: KDYFGRWQOYBRFD-JCDJMFQYSA-N.
| Molecular formula | C4H6O4 |
|---|---|
| Molecular weight | 122.059 g/mol |
| IUPAC name | (1,2,3,4-13C4)butanedioic acid |
| InChIKey | KDYFGRWQOYBRFD-JCDJMFQYSA-N |
| SMILES | [13CH2]([13CH2][13C](=O)O)[13C](=O)O |
Computed by PubChem (NCBI)