Products 21668-90-6
CAS 21668-90-6 appears in our catalog under these names: Succinic Acid-d6, 98 atom % D, min 98% Chemical Purity, Succinic acid–d6, SUCCINIC ACID-D6, 98 ATOM % D, Succinic acid-d6, 99.0%. Offered by: CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1g, 10mg, 100mg, 25mg, 50mg, 5G, 25 mg, 5 mg.
Dideuterio 2,2,3,3-tetradeuteriobutanedioate (CAS 21668-90-6) is a chemical compound with the molecular formula C4H6O4 and a molecular weight of 124.12 g/mol. IUPAC name: dideuterio 2,2,3,3-tetradeuteriobutanedioate. InChIKey: KDYFGRWQOYBRFD-DTDGFSOZSA-N.
| Molecular formula | C4H6O4 |
|---|---|
| Molecular weight | 124.12 g/mol |
| IUPAC name | dideuterio 2,2,3,3-tetradeuteriobutanedioate |
| InChIKey | KDYFGRWQOYBRFD-DTDGFSOZSA-N |
| SMILES | [2H]C([2H])(C(=O)O[2H])C([2H])([2H])C(=O)O[2H] |
Computed by PubChem (NCBI)