CAS 201595-71-3 appears in our catalog under these names: L-(+)-Lactic Acid-13C3 Sodium Salt, L-(+)-Lactic Acid-13C3 Sodium Salt (20% W/W in H2O), L-Lactic acid-13C3 sodium, 98% 98%atom%13C, L–Lactic acid–13C3 sodium, Sodium L-lactate-13C3. Offered by: TRC, AmBeed, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 10mg, 50mg, 5mg, 1g, 1mg(200mg/ml * 5ul in water), 10mg (200mg/ml * 50ul in water), 25mg (200mg/ml * 125ul in water), 5mg(200mg/ml * 25ul in water).
Sodium (2S)-2-hydroxy(1,2,3-13C3)propanoate (CAS 201595-71-3) is a chemical compound with the molecular formula C3H5NaO3 and a molecular weight of 115.038 g/mol. IUPAC name: sodium (2S)-2-hydroxy(1,2,3-13C3)propanoate. InChIKey: NGSFWBMYFKHRBD-USULVYIHSA-M.
| Molecular formula | C3H5NaO3 |
|---|---|
| Molecular weight | 115.038 g/mol |
| IUPAC name | sodium (2S)-2-hydroxy(1,2,3-13C3)propanoate |
| InChIKey | NGSFWBMYFKHRBD-USULVYIHSA-M |
| SMILES | [13CH3][13C@@H]([13C](=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)