CAS 285979-84-2 appears in our catalog under these names: Sodium (S)–2–hydroxypropanoate–d3, L-Lactic Acid-d3 Sodium Salt, Sodium L-Lactate-3,3,3-d3, 98 atom % D, min 96% Chemical Purity, SODIUM L-LACTATE-3,3,3-D3 SOLUTION, 45-&, L-Lactic acid-d3 (sodium), 98.31%. Offered by: GLPBio, TRC, CDN, Sigma-Aldrich, MedChemExpress. Available pack sizes: 10mg, 5mg, 2,5mg, 25mg, 0,05g, 1G, 5 mg, 10 mg.
Sodium (2S)-3,3,3-trideuterio-2-hydroxypropanoate (CAS 285979-84-2) is a chemical compound with the molecular formula C3H5NaO3 and a molecular weight of 115.08 g/mol. IUPAC name: sodium (2S)-3,3,3-trideuterio-2-hydroxypropanoate. InChIKey: NGSFWBMYFKHRBD-QQAVFRBQSA-M.
| Molecular formula | C3H5NaO3 |
|---|---|
| Molecular weight | 115.08 g/mol |
| IUPAC name | sodium (2S)-3,3,3-trideuterio-2-hydroxypropanoate |
| InChIKey | NGSFWBMYFKHRBD-QQAVFRBQSA-M |
| SMILES | [2H]C([2H])([2H])[C@@H](C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)