CAS 285979-83-1 appears in our catalog under these names: Sodium L-Lactate-2-d1, 98 atom % D, min 98% Chemical Purity, L-Lactic acid-2-d1 (sodium). Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1mg, 5mg.
Sodium (2S)-2-deuterio-2-hydroxypropanoate (CAS 285979-83-1) is a chemical compound with the molecular formula C3H5NaO3 and a molecular weight of 113.07 g/mol. IUPAC name: sodium (2S)-2-deuterio-2-hydroxypropanoate. InChIKey: NGSFWBMYFKHRBD-QEKRQAICSA-M.
| Molecular formula | C3H5NaO3 |
|---|---|
| Molecular weight | 113.07 g/mol |
| IUPAC name | sodium (2S)-2-deuterio-2-hydroxypropanoate |
| InChIKey | NGSFWBMYFKHRBD-QEKRQAICSA-M |
| SMILES | [2H][C@](C)(C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)